EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H19F4N7O |
| Net Charge | 0 |
| Average Mass | 497.456 |
| Monoisotopic Mass | 497.15872 |
| SMILES | C=CC(=O)Nc1ccc(F)c(Nc2nc(Nc3cnn(C)c3)ncc2-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C24H19F4N7O/c1-3-21(36)31-16-8-9-19(25)20(10-16)33-22-18(14-4-6-15(7-5-14)24(26,27)28)12-29-23(34-22)32-17-11-30-35(2)13-17/h3-13H,1H2,2H3,(H,31,36)(H2,29,32,33,34) |
| InChIKey | XIMJCWSFLXXQMZ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pebezertinib (CHEBI:760324) has role antineoplastic agent (CHEBI:35610) |
| pebezertinib (CHEBI:760324) is a (trifluoromethyl)benzenes (CHEBI:83565) |
| INN | Source |
|---|---|
| pebezertinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BLU-203139; | ChEMBL |
| BLU203139 | ChEMBL |
| BLU203139; | ChEMBL |
| BLU-451 | ChEMBL |