EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H19ClF2N4O3S |
| Net Charge | 0 |
| Average Mass | 528.968 |
| Monoisotopic Mass | 528.08345 |
| SMILES | [H][C@@]12CCOc3c(cc(F)c(-c4ccc(F)c5sc(N)c(C#N)c45)c3Cl)C(=O)N1CCN(C(=O)C=C)C2 |
| InChI | InChI=1S/C25H19ClF2N4O3S/c1-2-18(33)31-6-7-32-12(11-31)5-8-35-22-14(25(32)34)9-17(28)20(21(22)26)13-3-4-16(27)23-19(13)15(10-29)24(30)36-23/h2-4,9,12H,1,5-8,11,30H2/t12-/m0/s1 |
| InChIKey | OZUPICRWMLEFCS-LBPRGKRZSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| olomorasib (CHEBI:760322) has role antineoplastic agent (CHEBI:35610) |
| olomorasib (CHEBI:760322) is a 1-benzothiophenes (CHEBI:38836) |
| INN | Source |
|---|---|
| olomorasib | WHO MedNet |
| Synonyms | Source |
|---|---|
| LY-3537982 | ChEMBL |
| LY3537982 | ChEMBL |