EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H25IO11 |
| Net Charge | 0 |
| Average Mass | 640.379 |
| Monoisotopic Mass | 640.04416 |
| SMILES | [H][C@]1(O[C@@H]2O[C@@H](C)[C@H](O)[C@@H](O)[C@H]2I)C[C@](O)(C(=O)CO)Cc2c(O)c3c(c(O)c21)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C26H25IO11/c1-9-19(30)24(35)18(27)25(37-9)38-13-7-26(36,14(29)8-28)6-12-15(13)23(34)17-16(22(12)33)20(31)10-4-2-3-5-11(10)21(17)32/h2-5,9,13,18-19,24-25,28,30,33-36H,6-8H2,1H3/t9-,13-,18+,19-,24-,25-,26-/m0/s1 |
| InChIKey | CIDNKDMVSINJCG-GKXONYSUSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| naxtarubicin (CHEBI:760320) has role antineoplastic agent (CHEBI:35610) |
| naxtarubicin (CHEBI:760320) is a anthracycline (CHEBI:48120) |
| INNs | Source |
|---|---|
| naxtarubicin | WHO MedNet |
| naxtarubicina | WHO MedNet |
| naxtarubicine | WHO MedNet |
| Synonyms | Source |
|---|---|
| Annamycin | ChEMBL |
| C-2632 | ChEMBL |
| C2632 | ChEMBL |