EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | H2O.C32H47FN6O4S.C6H8O7 |
| Net Charge | 0 |
| Average Mass | 840.969 |
| Monoisotopic Mass | 840.37392 |
| SMILES | CCN(C(=O)c1cc(F)ccc1Oc1cncnc1N1CC2(CCN(C[C@H]3CC[C@H](NS(=O)(=O)CC)CC3)CC2)C1)C(C)C.O.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C32H47FN6O4S.C6H8O7.H2O/c1-5-39(23(3)4)31(40)27-17-25(33)9-12-28(27)43-29-18-34-22-35-30(29)38-20-32(21-38)13-15-37(16-14-32)19-24-7-10-26(11-8-24)36-44(41,42)6-2;7-3(8)1-6(13,5(11)12)2-4(9)10;/h9,12,17-18,22-24,26,36H,5-8,10-11,13-16,19-21H2,1-4H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H2/t24-,26-;; |
| InChIKey | UBXFWTFPYATLBT-SGBGZXBGSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| revumenib citrate (CHEBI:760308) has role antineoplastic agent (CHEBI:35610) |
| revumenib citrate (CHEBI:760308) is a aromatic ether (CHEBI:35618) |
| Synonyms | Source |
|---|---|
| Revumenib citrate | ChEMBL |
| Revumenib monocitrate monohydrate | ChEMBL |
| SNDX-5613 monocitrate monohydrate | ChEMBL |
| Brand Name | Source |
|---|---|
| Revuforj | ChEMBL |