EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HBr.C24H33N7O2 |
| Net Charge | 0 |
| Average Mass | 532.487 |
| Monoisotopic Mass | 531.19574 |
| SMILES | Br.CC(=O)N[C@H]1CC[C@H](NC(=O)CN2CCN(c3nncc(-c4ccc(C)cc4)n3)CC2)CC1 |
| InChI | InChI=1S/C24H33N7O2.BrH/c1-17-3-5-19(6-4-17)22-15-25-29-24(28-22)31-13-11-30(12-14-31)16-23(33)27-21-9-7-20(8-10-21)26-18(2)32;/h3-6,15,20-21H,7-14,16H2,1-2H3,(H,26,32)(H,27,33);1H/t20-,21-; |
| InChIKey | XQIXTASWTUQJIA-HBUVDCARSA-N |
| Roles Classification |
|---|
| Applications: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lorundrostat hydrobromide (CHEBI:760306) has role antihypertensive agent (CHEBI:35674) |
| lorundrostat hydrobromide (CHEBI:760306) has role cardiovascular drug (CHEBI:35554) |
| lorundrostat hydrobromide (CHEBI:760306) is a amino acid amide (CHEBI:22475) |
| Synonyms | Source |
|---|---|
| Lorundrostat hydrobromide | ChEMBL |
| MLS101 | ChEMBL |
| MLS-101 hydrobromide | ChEMBL |
| MT4129 | ChEMBL |
| MT-4129 hydrobromide | ChEMBL |