EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30N5O10P.H3O4P |
| Net Charge | 0 |
| Average Mass | 617.442 |
| Monoisotopic Mass | 617.14992 |
| SMILES | CC(C)OC(=O)OCOP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)OCOC(=O)OC(C)C.O=P(O)(O)O |
| InChI | InChI=1S/C19H30N5O10P.H3O4P/c1-12(2)33-18(25)28-9-31-35(27,32-10-29-19(26)34-13(3)4)11-30-14(5)6-24-8-23-15-16(20)21-7-22-17(15)24;1-5(2,3)4/h7-8,12-14H,6,9-11H2,1-5H3,(H2,20,21,22);(H3,1,2,3,4)/t14-;/m1./s1 |
| InChIKey | DJCLNKKHALBVLK-PFEQFJNWSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenofovir disoproxil phosphate (CHEBI:760255) has role anti-HBV agent (CHEBI:64951) |
| tenofovir disoproxil phosphate (CHEBI:760255) has role anti-HIV agent (CHEBI:64946) |
| tenofovir disoproxil phosphate (CHEBI:760255) is a purines (CHEBI:26401) |
| Synonym | Source |
|---|---|
| Tenofovir disoproxil phosphate | ChEMBL |
| Brand Name | Source |
|---|---|
| Tenofovir disoproxil zentiva | ChEMBL |