EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | HCl.C25H28N6O |
| Net Charge | 0 |
| Average Mass | 465.001 |
| Monoisotopic Mass | 464.20914 |
| SMILES | CCCCC1=NC2(CCCC2)C(=O)N1Cc1ccc(-c2ccccc2-c2nnnn2)cc1.Cl |
| InChI | InChI=1S/C25H28N6O.ClH/c1-2-3-10-22-26-25(15-6-7-16-25)24(32)31(22)17-18-11-13-19(14-12-18)20-8-4-5-9-21(20)23-27-29-30-28-23;/h4-5,8-9,11-14H,2-3,6-7,10,15-17H2,1H3,(H,27,28,29,30);1H |
| InChIKey | ZUYFSRQJPNUOQU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| irbesartan hydrochloride (CHEBI:760253) has role antihypertensive agent (CHEBI:35674) |
| irbesartan hydrochloride (CHEBI:760253) is a α-amino acid (CHEBI:33704) |
| Brand Name | Source |
|---|---|
| Ifirmasta (previously irbesartan krka) | ChEMBL |