EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O3S.C16H16ClNO2S |
| Net Charge | 0 |
| Average Mass | 480.007 |
| Monoisotopic Mass | 479.06279 |
| SMILES | COC(=O)[C@H](c1ccccc1Cl)N1CCc2sccc2C1.O=S(=O)(O)c1ccccc1 |
| InChI | InChI=1S/C16H16ClNO2S.C6H6O3S/c1-20-16(19)15(12-4-2-3-5-13(12)17)18-8-6-14-11(10-18)7-9-21-14;7-10(8,9)6-4-2-1-3-5-6/h2-5,7,9,15H,6,8,10H2,1H3;1-5H,(H,7,8,9)/t15-;/m0./s1 |
| InChIKey | CUZIJKLLBDXNFV-RSAXXLAASA-N |
| Roles Classification |
|---|
| Application: | cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| clopidogrel besilate (CHEBI:760247) has role cardiovascular drug (CHEBI:35554) |
| clopidogrel besilate (CHEBI:760247) is a α-amino acid ester (CHEBI:46874) |
| Synonym | Source |
|---|---|
| Clopidogrel besylate | ChEMBL |
| Brand Names | Source |
|---|---|
| Clopidogrel 1a pharma | ChEMBL |
| Clopidogrel 1a-pharma | ChEMBL |
| Clopidogrel acino | ChEMBL |
| Clopidogrel acino pharma | ChEMBL |
| Clopidogrel acino pharma gmbh | ChEMBL |
| Clopidogrel apotex | ChEMBL |