EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C4H4O4.C19H30N5O10P |
| Net Charge | 0 |
| Average Mass | 635.520 |
| Monoisotopic Mass | 635.18399 |
| SMILES | CC(C)OC(=O)OCOP(=O)(CO[C@H](C)Cn1cnc2c(N)ncnc21)OCOC(=O)OC(C)C.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H30N5O10P.C4H4O4/c1-12(2)33-18(25)28-9-31-35(27,32-10-29-19(26)34-13(3)4)11-30-14(5)6-24-8-23-15-16(20)21-7-22-17(15)24;5-3(6)1-2-4(7)8/h7-8,12-14H,6,9-11H2,1-5H3,(H2,20,21,22);1-2H,(H,5,6)(H,7,8)/b;2-1-/t14-;/m1./s1 |
| InChIKey | VCMJCVGFSROFHV-VIEYUMQNSA-N |
| Roles Classification |
|---|
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. anti-HBV agent An antiviral agent that destroys or inhibits the replication of the hepatitis B virus. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| tenofovir disoproxil maleate (CHEBI:760246) has role anti-HBV agent (CHEBI:64951) |
| tenofovir disoproxil maleate (CHEBI:760246) has role anti-HIV agent (CHEBI:64946) |
| tenofovir disoproxil maleate (CHEBI:760246) is a purines (CHEBI:26401) |
| Synonym | Source |
|---|---|
| Tenofovir disoproxil maleate | ChEMBL |
| Brand Name | Source |
|---|---|
| Tenofovir disoproxil mylan | ChEMBL |