EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:760243 - eltrombopag choline
| Formula | C5H14NO.C25H21N4O4 |
| Net Charge | 0 |
| Average Mass | 545.640 |
| Monoisotopic Mass | 545.26382 |
| SMILES | CC1=NN(c2ccc(C)c(C)c2)C(=O)/C1=N\Nc1cccc(-c2cccc(C(=O)[O-])c2)c1O.C[N+](C)(C)CCO |
| InChI | InChI=1S/C25H22N4O4.C5H14NO/c1-14-10-11-19(12-15(14)2)29-24(31)22(16(3)28-29)27-26-21-9-5-8-20(23(21)30)17-6-4-7-18(13-17)25(32)33;1-6(2,3)4-5-7/h4-13,26,30H,1-3H3,(H,32,33);7H,4-5H2,1-3H3/q;+1/p-1/b27-22-; |
| InChIKey | XSHFVAAXJHNDKZ-OUFJFOJPSA-M |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| eltrombopag choline (CHEBI:760243) has role anti-anaemic agent (CHEBI:75835) |
| eltrombopag choline (CHEBI:760243) has role antiviral agent (CHEBI:22587) |
| eltrombopag choline (CHEBI:760243) is a benzoic acids (CHEBI:22723) |
| Synonym | Source |
|---|---|
| Eltrombopag choline | ChEMBL |
| Brand Name | Source |
|---|---|
| Alvaiz | ChEMBL |