EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H14N2O2.C5H9NO3S |
| Net Charge | 0 |
| Average Mass | 309.388 |
| Monoisotopic Mass | 309.13584 |
| SMILES | CC(=O)N[C@@H](CS)C(=O)O.NCCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H14N2O2.C5H9NO3S/c7-4-2-1-3-5(8)6(9)10;1-3(7)6-4(2-10)5(8)9/h5H,1-4,7-8H2,(H,9,10);4,10H,2H2,1H3,(H,6,7)(H,8,9)/t5-;4-/m00/s1 |
| InChIKey | YLCSLYZPLGQZJS-VDQHJUMDSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| acetylcysteine lysine (CHEBI:760242) is a N-acyl-amino acid (CHEBI:51569) |
| Synonym | Source |
|---|---|
| Acetylcysteine lysine | ChEMBL |
| Brand Name | Source |
|---|---|
| Legubeti | ChEMBL |