EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H21ClF2N4O4 |
| Net Charge | 0 |
| Average Mass | 466.872 |
| Monoisotopic Mass | 466.12194 |
| SMILES | N=C(N)c1ccc(CNC(=O)[C@@H]2CCN2C(=O)[C@H](O)c2cc(Cl)cc(OC(F)F)c2)cc1 |
| InChI | InChI=1S/C21H21ClF2N4O4/c22-14-7-13(8-15(9-14)32-21(23)24)17(29)20(31)28-6-5-16(28)19(30)27-10-11-1-3-12(4-2-11)18(25)26/h1-4,7-9,16-17,21,29H,5-6,10H2,(H3,25,26)(H,27,30)/t16-,17+/m0/s1 |
| InChIKey | QTUUCFVBSVJGOH-DLBZAZTESA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| atecegatran (CHEBI:760238) is a α-amino acid (CHEBI:33704) |
| Synonyms | Source |
|---|---|
| AR-H 067637 | ChEMBL |
| AR-H-067637 | ChEMBL |
| AR-H067637 | ChEMBL |
| ARH-067637 | ChEMBL |
| Atecegatran | ChEMBL |