EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H19N2S.Cl |
| Net Charge | 0 |
| Average Mass | 318.873 |
| Monoisotopic Mass | 318.09575 |
| SMILES | Cc1ccc2c(c1)sc(-c1ccc(N(C)C)cc1)[n+]2C.[Cl-] |
| InChI | InChI=1S/C17H19N2S.ClH/c1-12-5-10-15-16(11-12)20-17(19(15)4)13-6-8-14(9-7-13)18(2)3;/h5-11H,1-4H3;1H/q+1;/p-1 |
| InChIKey | JADVWWSKYZXRGX-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. fluorochrome A fluorescent dye used to stain biological specimens. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thioflavine T (CHEBI:76023) has part thioflavin T cation (CHEBI:76034) |
| thioflavine T (CHEBI:76023) has role fluorochrome (CHEBI:51217) |
| thioflavine T (CHEBI:76023) has role geroprotector (CHEBI:176497) |
| thioflavine T (CHEBI:76023) has role histological dye (CHEBI:77178) |
| thioflavine T (CHEBI:76023) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium chloride |
| Synonyms | Source |
|---|---|
| ThT | SUBMITTER |
| C.I. 49005 | ChEBI |
| basic yellow 1 | ChEBI |
| C.I. Basic Yellow 1 | ChemIDplus |
| 2-(4-(Dimethylamino)phenyl)-3,6-dimethylbenzothiazolium chloride | ChemIDplus |
| Thioflavin T | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| WO2007011834 | Patent |
| WO2006006172 | Patent |
| Thioflavin_T | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3922452 | Reaxys |
| CAS:2390-54-7 | ChemIDplus |
| Citations |
|---|