EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:76023 - thioflavine T
| Formula | C17H19N2S.Cl |
| Net Charge | 0 |
| Average Mass | 318.873 |
| Monoisotopic Mass | 318.09575 |
| SMILES | Cc1ccc2c(c1)sc(-c1ccc(N(C)C)cc1)[n+]2C.[Cl-] |
| InChI | InChI=1S/C17H19N2S.ClH/c1-12-5-10-15-16(11-12)20-17(19(15)4)13-6-8-14(9-7-13)18(2)3;/h5-11H,1-4H3;1H/q+1;/p-1 |
| InChIKey | JADVWWSKYZXRGX-UHFFFAOYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Applications: | fluorochrome A fluorescent dye used to stain biological specimens. histological dye A dye used in microscopic or electron microscopic examination of cells and tissues to give contrast and to highlight particular features of interest, such as nuclei and cytoplasm. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| thioflavine T (CHEBI:76023) has part thioflavin T cation (CHEBI:76034) |
| thioflavine T (CHEBI:76023) has role fluorochrome (CHEBI:51217) |
| thioflavine T (CHEBI:76023) has role geroprotector (CHEBI:176497) |
| thioflavine T (CHEBI:76023) has role histological dye (CHEBI:77178) |
| thioflavine T (CHEBI:76023) is a organic chloride salt (CHEBI:36094) |
| IUPAC Name |
|---|
| 2-[4-(dimethylamino)phenyl]-3,6-dimethyl-1,3-benzothiazol-3-ium chloride |
| Synonyms | Source |
|---|---|
| 2-(4-(Dimethylamino)phenyl)-3,6-dimethylbenzothiazolium chloride | ChemIDplus |
| basic yellow 1 | ChEBI |
| C.I. 49005 | ChEBI |
| C.I. Basic Yellow 1 | ChemIDplus |
| Thioflavin T | ChemIDplus |
| ThT | SUBMITTER |
| Manual Xrefs | Databases |
|---|---|
| Thioflavin_T | Wikipedia |
| WO2006006172 | Patent |
| WO2007011834 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:3922452 | Reaxys |
| CAS:2390-54-7 | ChemIDplus |
| Citations |
|---|