EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22O8 |
| Net Charge | 0 |
| Average Mass | 402.399 |
| Monoisotopic Mass | 402.13147 |
| SMILES | COc1ccc(-c2cc(=O)c3c(OC)c(OC)c(OC)c(OC)c3o2)cc1OC |
| InChI | InChI=1S/C21H22O8/c1-23-13-8-7-11(9-15(13)24-2)14-10-12(22)16-17(25-3)19(26-4)21(28-6)20(27-5)18(16)29-14/h7-10H,1-6H3 |
| InChIKey | MRIAQLRQZPPODS-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nobiletin (CHEBI:7602) has functional parent flavone (CHEBI:42491) |
| nobiletin (CHEBI:7602) has role antineoplastic agent (CHEBI:35610) |
| nobiletin (CHEBI:7602) has role plant metabolite (CHEBI:76924) |
| nobiletin (CHEBI:7602) is a methoxyflavone (CHEBI:25241) |
| IUPAC Name |
|---|
| 2-(3,4-dimethoxyphenyl)-5,6,7,8-tetramethoxy-4H-1-benzopyran-4-one |
| Synonyms | Source |
|---|---|
| 5,6,7,8,3',4'-Hexamethoxyflavone | KEGG COMPOUND |
| Hexamethoxyflavone | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| C00001076 | KNApSAcK |
| C10112 | KEGG COMPOUND |
| HMDB0029540 | HMDB |
| LMPK12111468 | LIPID MAPS |
| LSM-2130 | LINCS |
| Nobiletin | Wikipedia |
| Citations |
|---|