EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19FN8O2 |
| Net Charge | 0 |
| Average Mass | 422.424 |
| Monoisotopic Mass | 422.16150 |
| SMILES | COC(=O)N(C)c1c(N)nc(-c2nn(Cc3ccccc3F)c3ncccc23)nc1N |
| InChI | InChI=1S/C20H19FN8O2/c1-28(20(30)31-2)15-16(22)25-18(26-17(15)23)14-12-7-5-9-24-19(12)29(27-14)10-11-6-3-4-8-13(11)21/h3-9H,10H2,1-2H3,(H4,22,23,25,26) |
| InChIKey | WXXSNCNJFUAIDG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). |
| Applications: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. cardiovascular drug A drug that affects the rate or intensity of cardiac contraction, blood vessel diameter or blood volume. anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| riociguat (CHEBI:76018) has role anti-anaemic agent (CHEBI:75835) |
| riociguat (CHEBI:76018) has role anti-HIV agent (CHEBI:64946) |
| riociguat (CHEBI:76018) has role anti-ulcer drug (CHEBI:49201) |
| riociguat (CHEBI:76018) has role antihypertensive agent (CHEBI:35674) |
| riociguat (CHEBI:76018) has role cardiovascular drug (CHEBI:35554) |
| riociguat (CHEBI:76018) has role soluble guanylate cyclase activator (CHEBI:76022) |
| riociguat (CHEBI:76018) is a aminopyrimidine (CHEBI:38338) |
| riociguat (CHEBI:76018) is a carbamate ester (CHEBI:23003) |
| riociguat (CHEBI:76018) is a organofluorine compound (CHEBI:37143) |
| riociguat (CHEBI:76018) is a pyrazolopyridine (CHEBI:46699) |
| IUPAC Name |
|---|
| methyl {4,6-diamino-2-[1-(2-fluorobenzyl)-1H-pyrazolo[3,4-b]pyridin-3-yl]pyrimidin-5-yl}methylcarbamate |
| INNs | Source |
|---|---|
| riociguat | KEGG DRUG |
| riociguat | WHO MedNet |
| riociguat | WHO MedNet |
| riociguatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY 63-2521 | ChemIDplus |
| BAY-63-2521 | ChEMBL |
| Methyl N-(4,6-diamino-2-{1-((2-fluorophenyl)methyl)-1H-pyrazolo(3,4-b)pyridin-3-yl}pyrimidin-5-yl)-N-methylcarbamate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Adempas | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4807 | DrugCentral |
| D09572 | KEGG DRUG |
| Riociguat | Wikipedia |
| US2009286781 | Patent |
| WO2007009607 | Patent |
| WO2011147810 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12581953 | Reaxys |
| CAS:625115-55-1 | KEGG DRUG |
| CAS:625115-55-1 | ChemIDplus |
| Citations |
|---|