EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H19FN8O2 |
| Net Charge | 0 |
| Average Mass | 422.424 |
| Monoisotopic Mass | 422.16150 |
| SMILES | COC(=O)N(C)c1c(N)nc(-c2nn(Cc3ccccc3F)c3ncccc23)nc1N |
| InChI | InChI=1S/C20H19FN8O2/c1-28(20(30)31-2)15-16(22)25-18(26-17(15)23)14-12-7-5-9-24-19(12)29(27-14)10-11-6-3-4-8-13(11)21/h3-9H,10H2,1-2H3,(H4,22,23,25,26) |
| InChIKey | WXXSNCNJFUAIDG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | soluble guanylate cyclase activator Any compound that binds to and activates soluble guanylate cyclase (EC 4.6.1.2). |
| Application: | antihypertensive agent Any drug used in the treatment of acute or chronic vascular hypertension regardless of pharmacological mechanism. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| riociguat (CHEBI:76018) has role antihypertensive agent (CHEBI:35674) |
| riociguat (CHEBI:76018) has role soluble guanylate cyclase activator (CHEBI:76022) |
| riociguat (CHEBI:76018) is a aminopyrimidine (CHEBI:38338) |
| riociguat (CHEBI:76018) is a carbamate ester (CHEBI:23003) |
| riociguat (CHEBI:76018) is a organofluorine compound (CHEBI:37143) |
| riociguat (CHEBI:76018) is a pyrazolopyridine (CHEBI:46699) |
| IUPAC Name |
|---|
| methyl {4,6-diamino-2-[1-(2-fluorobenzyl)-1H-pyrazolo[3,4-b]pyridin-3-yl]pyrimidin-5-yl}methylcarbamate |
| INNs | Source |
|---|---|
| riociguat | WHO MedNet |
| riociguat | KEGG DRUG |
| riociguat | WHO MedNet |
| riociguatum | WHO MedNet |
| Synonyms | Source |
|---|---|
| BAY 63-2521 | ChemIDplus |
| Methyl N-(4,6-diamino-2-{1-((2-fluorophenyl)methyl)-1H-pyrazolo(3,4-b)pyridin-3-yl}pyrimidin-5-yl)-N-methylcarbamate | ChemIDplus |
| Brand Name | Source |
|---|---|
| Adempas | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4807 | DrugCentral |
| D09572 | KEGG DRUG |
| Riociguat | Wikipedia |
| US2009286781 | Patent |
| WO2007009607 | Patent |
| WO2011147810 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12581953 | Reaxys |
| CAS:625115-55-1 | KEGG DRUG |
| CAS:625115-55-1 | ChemIDplus |
| Citations |
|---|