EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N5O2S2 |
| Net Charge | 0 |
| Average Mass | 331.467 |
| Monoisotopic Mass | 331.11367 |
| SMILES | CNC(=C[N+](=O)[O-])NCCSCc1csc(CN(C)C)n1 |
| InChI | InChI=1S/C12H21N5O2S2/c1-13-11(6-17(18)19)14-4-5-20-8-10-9-21-12(15-10)7-16(2)3/h6,9,13-14H,4-5,7-8H2,1-3H3 |
| InChIKey | SGXXNSQHWDMGGP-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. |
| Applications: | anti-ulcer drug One of various classes of drugs with different action mechanisms used to treat or ameliorate peptic ulcer or irritation of the gastrointestinal tract. cholinergic drug Any drug used for its actions on cholinergic systems. Included here are agonists and antagonists, drugs that affect the life cycle of acetylcholine, and drugs that affect the survival of cholinergic neurons. H2-receptor antagonist H2-receptor antagonists are the drugs that selectively bind to but do not activate histamine H2 receptors, thereby blocking the actions of endogenous histamine. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| nizatidine (CHEBI:7601) has role anti-ulcer drug (CHEBI:49201) |
| nizatidine (CHEBI:7601) has role cholinergic drug (CHEBI:38323) |
| nizatidine (CHEBI:7601) has role H2-receptor antagonist (CHEBI:37961) |
| nizatidine (CHEBI:7601) is a C-nitro compound (CHEBI:35716) |
| nizatidine (CHEBI:7601) is a 1,3-thiazoles (CHEBI:38418) |
| nizatidine (CHEBI:7601) is a carboxamidine (CHEBI:35359) |
| nizatidine (CHEBI:7601) is a organic sulfide (CHEBI:16385) |
| nizatidine (CHEBI:7601) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-{2-[({2-[(dimethylamino)methyl]-1,3-thiazol-4-yl}methyl)sulfanyl]ethyl}-N'-methyl-2-nitroethene-1,1-diamine |
| INNs | Source |
|---|---|
| nizatidina | ChemIDplus |
| nizatidine | KEGG DRUG |
| nizatidine | WHO MedNet |
| nizatidinum | ChemIDplus |
| Synonym | Source |
|---|---|
| N-(4-(6-Methylamino-7-nitro-2-thia-5-aza-6-hepten-1-yl)-2-thiazolylmethyl)-N,N-dimethylamine | ChemIDplus |
| Brand Names | Source |
|---|---|
| Acinon | KEGG DRUG |
| Axid | KEGG DRUG |
| Manual Xrefs | Databases |
|---|---|
| 1955 | DrugCentral |
| C07270 | KEGG COMPOUND |
| D00440 | KEGG DRUG |
| DB00585 | DrugBank |
| HMDB0014723 | HMDB |
| LSM-3031 | LINCS |
| Nizatidine | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4846056 | Reaxys |
| CAS:76963-41-2 | KEGG COMPOUND |
| CAS:76963-41-2 | ChemIDplus |
| Citations |
|---|