EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18F2N3O5.Na |
| Net Charge | 0 |
| Average Mass | 441.366 |
| Monoisotopic Mass | 441.11122 |
| SMILES | [H][C@]12Cn3cc(C(=O)NCc4ccc(F)cc4F)c(=O)c([O-])c3C(=O)N1[C@H](C)CCO2.[Na+] |
| InChI | InChI=1S/C20H19F2N3O5.Na/c1-10-4-5-30-15-9-24-8-13(17(26)18(27)16(24)20(29)25(10)15)19(28)23-7-11-2-3-12(21)6-14(11)22;/h2-3,6,8,10,15,27H,4-5,7,9H2,1H3,(H,23,28);/q;+1/p-1/t10-,15+;/m1./s1 |
| InChIKey | UGWJRRXTMKRYNK-VSLILLSYSA-M |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | HIV-1 integrase inhibitor An inhibitor of HIV-1 integrase, an enzyme required for the integration of the genetic material of the retrovirus into the DNA of the infected cells. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dolutegravir sodium (CHEBI:76007) has part dolutegravir(1−) (CHEBI:76014) |
| dolutegravir sodium (CHEBI:76007) has role HIV-1 integrase inhibitor (CHEBI:67268) |
| dolutegravir sodium (CHEBI:76007) is a organic sodium salt (CHEBI:38700) |
| IUPAC Name |
|---|
| sodium (4R,12aS)-9-[(2,4-difluorobenzyl)carbamoyl]-4-methyl-6,8-dioxo-3,4,6,8,12,12a-hexahydro-2H-pyrido[1',2':4,5]pyrazino[2,1-b][1,3]oxazin-7-olate |
| Synonyms | Source |
|---|---|
| GSK 1349572A | ChemIDplus |
| GSK1349572A | ChemIDplus |
| Brand Name | Source |
|---|---|
| Tivicay | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| D10113 | KEGG DRUG |
| Dolutegravir | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20386344 | Reaxys |
| CAS:1051375-19-9 | KEGG DRUG |
| CAS:1051375-19-9 | ChemIDplus |
| Citations |
|---|