EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22N4OS |
| Net Charge | 0 |
| Average Mass | 378.501 |
| Monoisotopic Mass | 378.15143 |
| SMILES | Cc1ccc(Oc2ccccc2-c2csc(N=C3NCCCN3)n2)c(C)c1 |
| InChI | InChI=1S/C21H22N4OS/c1-14-8-9-18(15(2)12-14)26-19-7-4-3-6-16(19)17-13-27-21(24-17)25-20-22-10-5-11-23-20/h3-4,6-9,12-13H,5,10-11H2,1-2H3,(H2,22,23,24,25) |
| InChIKey | TYBHXIFFPVFXQW-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| Application: | antifungal drug Any antifungal agent used to prevent or treat fungal infections in humans or animals. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| abafungin (CHEBI:76005) has role antifungal drug (CHEBI:86327) |
| abafungin (CHEBI:76005) is a 1,3-thiazoles (CHEBI:38418) |
| abafungin (CHEBI:76005) is a aromatic ether (CHEBI:35618) |
| abafungin (CHEBI:76005) is a guanidines (CHEBI:24436) |
| IUPAC Name |
|---|
| N-{4-[2-(2,4-dimethylphenoxy)phenyl]-1,3-thiazol-2-yl}tetrahydropyrimidin-2(1H)-imine |
| INNs | Source |
|---|---|
| abafungin | ChemIDplus |
| abafungine | WHO MedNet |
| abafungina | WHO MedNet |
| abafunginum | WHO MedNet |
| Brand Name | Source |
|---|---|
| Abasol | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Abafungin | Wikipedia |
| WO2009043307 | Patent |
| CN101845044 | Patent |
| CN101372486 | Patent |
| CN101396363 | Patent |
| CN1969874 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:11337934 | Reaxys |
| CAS:129639-79-8 | ChemIDplus |
| Citations |
|---|