EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:76004 - dimethyl fumarate
| Formula | C6H8O4 |
| Net Charge | 0 |
| Average Mass | 144.126 |
| Monoisotopic Mass | 144.04226 |
| SMILES | COC(=O)/C=C/C(=O)OC |
| InChI | InChI=1S/C6H8O4/c1-9-5(7)3-4-6(8)10-2/h3-4H,1-2H3/b4-3+ |
| InChIKey | LDCRTTXIJACKKU-ONEGZZNKSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antiviral agent A substance that destroys or inhibits replication of viruses. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. |
| Applications: | immunomodulator Biologically active substance whose activity affects or plays a role in the functioning of the immune system. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antirheumatic drug A drug used to treat rheumatoid arthritis. immunosuppressive agent An agent that suppresses immune function by one of several mechanisms of action. Classical cytotoxic immunosuppressants act by inhibiting DNA synthesis. Others may act through activation of T-cells or by inhibiting the activation of helper cells. In addition, an immunosuppressive agent is a role played by a compound which is exhibited by a capability to diminish the extent and/or voracity of an immune response. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dimethyl fumarate (CHEBI:76004) has functional parent fumaric acid (CHEBI:18012) |
| dimethyl fumarate (CHEBI:76004) has functional parent methanol (CHEBI:17790) |
| dimethyl fumarate (CHEBI:76004) has role antineoplastic agent (CHEBI:35610) |
| dimethyl fumarate (CHEBI:76004) has role antipsoriatic (CHEBI:50748) |
| dimethyl fumarate (CHEBI:76004) has role antirheumatic drug (CHEBI:35842) |
| dimethyl fumarate (CHEBI:76004) has role antiviral agent (CHEBI:22587) |
| dimethyl fumarate (CHEBI:76004) has role immunomodulator (CHEBI:50846) |
| dimethyl fumarate (CHEBI:76004) has role immunosuppressive agent (CHEBI:35705) |
| dimethyl fumarate (CHEBI:76004) is a diester (CHEBI:51307) |
| dimethyl fumarate (CHEBI:76004) is a enoate ester (CHEBI:51702) |
| dimethyl fumarate (CHEBI:76004) is a methyl ester (CHEBI:25248) |
| IUPAC Name |
|---|
| dimethyl (2E)-but-2-enedioate |
| Synonyms | Source |
|---|---|
| 1,2-bis(methoxycarbonyl)-trans-ethylene | HMDB |
| AZL 0 211089 | ChEMBL |
| AZL-0211089 | ChEMBL |
| AZL O 211089 | ChEMBL |
| AZL-O-211089 | ChEMBL |
| BG 00012 | ChEMBL |
| Brand Names | Source |
|---|---|
| Dimethyl fumarate accord | ChEMBL |
| Dimethyl fumarate mylan | ChEMBL |
| Dimethyl fumarate neuraxpharm | ChEMBL |
| Dimethyl fumarate polpharma | ChEMBL |
| Dimethyl fumarate teva | ChEMBL |
| Skilarence | ChEMBL |
| Manual Xrefs | Databases |
|---|---|
| 4757 | DrugCentral |
| D03846 | KEGG DRUG |
| DB08908 | DrugBank |
| Dimethyl_fumarate | Wikipedia |
| HMDB0031257 | HMDB |
| US2008089861 | Patent |
| WO2011100589 | Patent |
| Citations |
|---|