EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H25F2N3O3 |
| Net Charge | 0 |
| Average Mass | 405.445 |
| Monoisotopic Mass | 405.18640 |
| SMILES | C[C@H]1CC[C@H](N2CC(=O)N(Cc3ccc(F)c(F)c3)C3(CN(C=O)C3)C2=O)CC1 |
| InChI | InChI=1S/C21H25F2N3O3/c1-14-2-5-16(6-3-14)25-10-19(28)26(9-15-4-7-17(22)18(23)8-15)21(20(25)29)11-24(12-21)13-27/h4,7-8,13-14,16H,2-3,5-6,9-12H2,1H3/t14-,16- |
| InChIKey | HLMGUFOCTBBSLK-KOMQPUFPSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ulacamten (CHEBI:759995) is a α-amino acid (CHEBI:33704) |
| INNs | Source |
|---|---|
| ulacamten | WHO MedNet |
| ulacamtene | WHO MedNet |