EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C41H29ClF9N9O4S |
| Net Charge | 0 |
| Average Mass | 950.244 |
| Monoisotopic Mass | 949.16080 |
| SMILES | [H][C@@]12C[C@]1([H])c1c(C(F)F)nn(CC(=O)N[C@@H](Cc3cc(F)cc(F)c3)c3nc4cc(-c5cccc(C(F)(F)F)n5)ccc4c(=O)n3-c3ccc(Cl)c4c(NS(C)(=O)=O)nn(C)c34)c1C2(F)F |
| InChI | InChI=1S/C41H29ClF9N9O4S/c1-58-34-28(9-8-24(42)32(34)37(56-58)57-65(2,63)64)60-38(54-26-13-18(6-7-21(26)39(60)62)25-4-3-5-29(52-25)41(49,50)51)27(12-17-10-19(43)14-20(44)11-17)53-30(61)16-59-35-31(33(55-59)36(45)46)22-15-23(22)40(35,47)48/h3-11,13-14,22-23,27,36H,12,15-16H2,1-2H3,(H,53,61)(H,56,57)/t22-,23+,27-/m0/s1 |
| InChIKey | CHCWDBMFOLTXQX-OBTVHEKISA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suricapavir (CHEBI:759994) has role antiviral agent (CHEBI:22587) |
| suricapavir (CHEBI:759994) is a quinazolines (CHEBI:38530) |
| INN | Source |
|---|---|
| suricapavir | WHO MedNet |