EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H30N8O2 |
| Net Charge | 0 |
| Average Mass | 522.613 |
| Monoisotopic Mass | 522.24917 |
| SMILES | COc1ccc(CN2C3CC2CN(c2ccc(-c4cc(N5CC(C)(O)C5)cn5ncc(C#N)c45)cn2)C3)cn1 |
| InChI | InChI=1S/C29H30N8O2/c1-29(38)17-35(18-29)22-8-25(28-21(9-30)12-33-37(28)16-22)20-4-5-26(31-11-20)34-14-23-7-24(15-34)36(23)13-19-3-6-27(39-2)32-10-19/h3-6,8,10-12,16,23-24,38H,7,13-15,17-18H2,1-2H3 |
| InChIKey | MVQAYSXDCGCOIE-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| soxataltinib (CHEBI:759993) has role antineoplastic agent (CHEBI:35610) |
| soxataltinib (CHEBI:759993) is a piperazines (CHEBI:26144) |
| soxataltinib (CHEBI:759993) is a pyridines (CHEBI:26421) |
| INN | Source |
|---|---|
| soxataltinib | WHO MedNet |