EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H25ClN4O5 |
| Net Charge | 0 |
| Average Mass | 484.940 |
| Monoisotopic Mass | 484.15135 |
| SMILES | COc1c(Cl)cccc1Nc1c(-c2ccncc2OC[C@@H]2COCCO2)nc2c1C(=O)NCC2 |
| InChI | InChI=1S/C24H25ClN4O5/c1-31-23-16(25)3-2-4-18(23)29-22-20-17(6-8-27-24(20)30)28-21(22)15-5-7-26-11-19(15)34-13-14-12-32-9-10-33-14/h2-5,7,11,14,28-29H,6,8-10,12-13H2,1H3,(H,27,30)/t14-/m0/s1 |
| InChIKey | VYQVHWNNPKOJEA-AWEZNQCLSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| sevabertinib (CHEBI:759992) has role antineoplastic agent (CHEBI:35610) |
| sevabertinib (CHEBI:759992) is a pyrrolopyridine (CHEBI:46771) |
| INN | Source |
|---|---|
| sevabertinib | WHO MedNet |