EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26NO4 |
| Net Charge | +1 |
| Average Mass | 344.431 |
| Monoisotopic Mass | 344.18563 |
| SMILES | COc1ccc(C[C@H]2c3cc(OC)c(OC)cc3CC[NH+]2C)cc1O |
| InChI | InChI=1S/C20H25NO4/c1-21-8-7-14-11-19(24-3)20(25-4)12-15(14)16(21)9-13-5-6-18(23-2)17(22)10-13/h5-6,10-12,16,22H,7-9H2,1-4H3/p+1/t16-/m0/s1 |
| InChIKey | MPYHGNAJOKCMAQ-INIZCTEOSA-O |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (S)-laudanine(1+) (CHEBI:75999) is a laudanine(1+) (CHEBI:76102) |
| (S)-laudanine(1+) (CHEBI:75999) is conjugate acid of (S)-laudanine (CHEBI:76101) |
| (S)-laudanine(1+) (CHEBI:75999) is enantiomer of (R)-laudanine(1+) (CHEBI:76001) |
| Incoming Relation(s) |
| (S)-laudanine (CHEBI:76101) is conjugate base of (S)-laudanine(1+) (CHEBI:75999) |
| (R)-laudanine(1+) (CHEBI:76001) is enantiomer of (S)-laudanine(1+) (CHEBI:75999) |
| IUPAC Name |
|---|
| (1S)-1-(3-hydroxy-4-methoxybenzyl)-6,7-dimethoxy-2-methyl-1,2,3,4-tetrahydroisoquinolinium |
| UniProt Name | Source |
|---|---|
| (S)-laudanine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-8924 | MetaCyc |
| Citations |
|---|