EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H22F2N2O6S |
| Net Charge | 0 |
| Average Mass | 540.544 |
| Monoisotopic Mass | 540.11666 |
| SMILES | COC(=O)OCOc1c2n(ccc1=O)N([C@@H]1c3ccccc3SCc3c1ccc(F)c3F)CC1(CC1)C2=O |
| InChI | InChI=1S/C27H22F2N2O6S/c1-35-26(34)37-14-36-24-19(32)8-11-30-23(24)25(33)27(9-10-27)13-31(30)22-15-6-7-18(28)21(29)17(15)12-38-20-5-3-2-4-16(20)22/h2-8,11,22H,9-10,12-14H2,1H3/t22-/m0/s1 |
| InChIKey | XNCHLCOISMLPJG-QFIPXVFZSA-N |
| Roles Classification |
|---|
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pixavir marboxil (CHEBI:759984) has role antiviral agent (CHEBI:22587) |
| pixavir marboxil (CHEBI:759984) is a dibenzothiepine (CHEBI:38924) |
| INNs | Source |
|---|---|
| pixavir marboxil | WHO MedNet |
| pixavir marboxilo | WHO MedNet |