EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C33H48FN7O4 |
| Net Charge | 0 |
| Average Mass | 625.790 |
| Monoisotopic Mass | 625.37518 |
| SMILES | [H][C@@](NC(=O)c1ccnn1CC)(C(=O)Nc1ccc([C@H](C)[C@@H](NC(=O)CC)C(=O)N2CCN(C)CC2)cc1F)[C@]1([H])CC[C@H](C)CC1 |
| InChI | InChI=1S/C33H48FN7O4/c1-6-28(42)37-29(33(45)40-18-16-39(5)17-19-40)22(4)24-12-13-26(25(34)20-24)36-32(44)30(23-10-8-21(3)9-11-23)38-31(43)27-14-15-35-41(27)7-2/h12-15,20-23,29-30H,6-11,16-19H2,1-5H3,(H,36,44)(H,37,42)(H,38,43)/t21-,22-,23+,29+,30-/m0/s1 |
| InChIKey | WEXJUHWVWXUMKQ-HBVAFZLXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| navepdekinra (CHEBI:759981) has role anti-inflammatory agent (CHEBI:67079) |
| navepdekinra (CHEBI:759981) is a N-acyl-amino acid (CHEBI:51569) |
| INN | Source |
|---|---|
| navepdekinra | WHO MedNet |