EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H23FIN5O4 |
| Net Charge | 0 |
| Average Mass | 615.403 |
| Monoisotopic Mass | 615.07788 |
| SMILES | CC(=O)Nc1cccc(-n2c(=O)n(C3CC3)c(=O)c3c(Nc4ccc(I)cc4F)n(C)c(=O)c(C)c32)c1 |
| InChI | InChI=1S/C26H23FIN5O4/c1-13-22-21(23(31(3)24(13)35)30-20-10-7-15(28)11-19(20)27)25(36)33(17-8-9-17)26(37)32(22)18-6-4-5-16(12-18)29-14(2)34/h4-7,10-12,17,30H,8-9H2,1-3H3,(H,29,34) |
| InChIKey | LIRYPHYGHXZJBZ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anticoronaviral agent Any antiviral agent which inhibits the activity of coronaviruses. EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor An EC 2.7.11.* (protein-serine/threonine kinase) inhibitor that interferes with the action of mitogen-activated protein kinase (EC 2.7.11.24). |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| trametinib (CHEBI:75998) has role anticoronaviral agent (CHEBI:149553) |
| trametinib (CHEBI:75998) has role antineoplastic agent (CHEBI:35610) |
| trametinib (CHEBI:75998) has role EC 2.7.11.24 (mitogen-activated protein kinase) inhibitor (CHEBI:79091) |
| trametinib (CHEBI:75998) has role geroprotector (CHEBI:176497) |
| trametinib (CHEBI:75998) is a acetamides (CHEBI:22160) |
| trametinib (CHEBI:75998) is a aromatic amine (CHEBI:33860) |
| trametinib (CHEBI:75998) is a cyclopropanes (CHEBI:51454) |
| trametinib (CHEBI:75998) is a organofluorine compound (CHEBI:37143) |
| trametinib (CHEBI:75998) is a organoiodine compound (CHEBI:37142) |
| trametinib (CHEBI:75998) is a pyridopyrimidine (CHEBI:38932) |
| trametinib (CHEBI:75998) is a ring assembly (CHEBI:36820) |
| Incoming Relation(s) |
| trametinib dimethyl sulfoxide (CHEBI:75991) has part trametinib (CHEBI:75998) |
| IUPAC Name |
|---|
| N-(3-{3-cyclopropyl-5-[(2-fluoro-4-iodophenyl)amino]-6,8-dimethyl-2,4,7-trioxo-3,4,6,7-tetrahydropyrido[4,3-d]pyrimidin-1(2H)-yl}phenyl)acetamide |
| INNs | Source |
|---|---|
| trametinib | WHO MedNet |
| trametinib | WHO MedNet |
| tramétinib | WHO MedNet |
| trametinibum | WHO MedNet |
| Synonyms | Source |
|---|---|
| GSK 1120212 | ChemIDplus |
| JTP 74057 | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| 4802 | DrugCentral |
| 9881833 | ChemSpider |
| D10175 | KEGG DRUG |
| DB08911 | DrugBank |
| LSM-1143 | LINCS |
| Trametinib | Wikipedia |
| WO2005121142 | Patent |
| WO2011038082 | Patent |
| WO2011038085 | Patent |
| WO2011047238 | Patent |
| Registry Numbers | Sources |
|---|---|
| Reaxys:12497153 | Reaxys |
| CAS:871700-17-3 | ChemIDplus |
| CAS:871700-17-3 | KEGG COMPOUND |
| Citations |
|---|