EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H17F2N5O4S |
| Net Charge | 0 |
| Average Mass | 461.450 |
| Monoisotopic Mass | 461.09693 |
| SMILES | Cn1cnc2ccc(Oc3c(F)ccc(NS(=O)(=O)N4CC[C@@H](F)C4)c3C#N)cc2c1=O |
| InChI | InChI=1S/C20H17F2N5O4S/c1-26-11-24-17-4-2-13(8-14(17)20(26)28)31-19-15(9-23)18(5-3-16(19)22)25-32(29,30)27-7-6-12(21)10-27/h2-5,8,11-12,25H,6-7,10H2,1H3/t12-/m1/s1 |
| InChIKey | ZUXPFTYMSHPRQX-GFCCVEGCSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| mosperafenib (CHEBI:759979) has role antineoplastic agent (CHEBI:35610) |
| mosperafenib (CHEBI:759979) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| mosperafenib | WHO MedNet |