EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H22F2IN5O4S |
| Net Charge | 0 |
| Average Mass | 665.460 |
| Monoisotopic Mass | 665.04053 |
| SMILES | Cn1c(=O)c(F)c(Nc2ccc(I)cc2F)c2c(=O)n(C3CC3)nc(-c3cccc(NS(=O)(=O)C4CC4)c3)c21 |
| InChI | InChI=1S/C26H22F2IN5O4S/c1-33-24-20(23(21(28)26(33)36)30-19-10-5-14(29)12-18(19)27)25(35)34(16-6-7-16)31-22(24)13-3-2-4-15(11-13)32-39(37,38)17-8-9-17/h2-5,10-12,16-17,30,32H,6-9H2,1H3 |
| InChIKey | RJFDJJABNSVLRB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| luvometinib (CHEBI:759977) has role antineoplastic agent (CHEBI:35610) |
| luvometinib (CHEBI:759977) is a pyridazines (CHEBI:37921) |
| luvometinib (CHEBI:759977) is a ring assembly (CHEBI:36820) |
| INN | Source |
|---|---|
| luvometinib | WHO MedNet |
| Synonyms | Source |
|---|---|
| Fcn-159 | ChEMBL |
| FCN159 | ChEMBL |