EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:759970 - fanregratinib
| Formula | C27H33ClN6O2 |
| Net Charge | 0 |
| Average Mass | 509.054 |
| Monoisotopic Mass | 508.23535 |
| SMILES | CNC(=O)c1cc(CCc2cnc(Nc3ccc(N4C[C@@H](C)N[C@@H](C)C4)cc3)nc2)c(Cl)c(OC)c1 |
| InChI | InChI=1S/C27H33ClN6O2/c1-17-15-34(16-18(2)32-17)23-9-7-22(8-10-23)33-27-30-13-19(14-31-27)5-6-20-11-21(26(35)29-3)12-24(36-4)25(20)28/h7-14,17-18,32H,5-6,15-16H2,1-4H3,(H,29,35)(H,30,31,33)/t17-,18+ |
| InChIKey | LVQABCJAWBLTAO-HDICACEKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fanregratinib (CHEBI:759970) has role antineoplastic agent (CHEBI:35610) |
| fanregratinib (CHEBI:759970) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| fanregratinib | WHO MedNet |