EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H29ClF9N9O5S |
| Net Charge | 0 |
| Average Mass | 918.199 |
| Monoisotopic Mass | 917.15572 |
| SMILES | [H][C@@]12C[C@]1([H])c1c(C(F)F)nn(CC(=O)N[C@@H](Cc3cc(F)cc(F)c3)c3nc4nc(OCCC(F)(F)F)ccc4c(=O)n3-c3ccc(Cl)c4c(NS(C)(=O)=O)nn(C)c34)c1C2(F)F |
| InChI | InChI=1S/C37H29ClF9N9O5S/c1-54-29-23(5-4-21(38)27(29)33(52-54)53-62(2,59)60)56-34(50-32-18(35(56)58)3-6-25(49-32)61-8-7-36(43,44)45)22(11-15-9-16(39)12-17(40)10-15)48-24(57)14-55-30-26(28(51-55)31(41)42)19-13-20(19)37(30,46)47/h3-6,9-10,12,19-20,22,31H,7-8,11,13-14H2,1-2H3,(H,48,57)(H,52,53)/t19-,20+,22-/m0/s1 |
| InChIKey | JBJQTRRKPQLQQB-VWPQPMDRSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | anti-HIV agent An antiviral agent that destroys or inhibits the replication of the human immunodeficiency virus. antiviral agent A substance that destroys or inhibits replication of viruses. |
| Application: | central nervous system stimulant Any drug that enhances the activity of the central nervous system. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dezecapavir (CHEBI:759966) has role anti-HIV agent (CHEBI:64946) |
| dezecapavir (CHEBI:759966) has role antiviral agent (CHEBI:22587) |
| dezecapavir (CHEBI:759966) is a amphetamines (CHEBI:35338) |
| INN | Source |
|---|---|
| dezecapavir | WHO MedNet |
| Synonyms | Source |
|---|---|
| Vh4011499 | ChEMBL |
| VH-4011499 | ChEMBL |
| VH-4011499A | ChEMBL |