EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H16D3FN6O2 |
| Net Charge | 0 |
| Average Mass | 409.439 |
| Monoisotopic Mass | 409.17418 |
| SMILES | [2H]C([2H])([2H])n1nc2c(c1C#N)-c1cnc(N)c(c1)O[C@H](C)c1cc(F)ccc1C(=O)N(C)C2 |
| InChI | InChI=1S/C21H19FN6O2/c1-11-15-7-13(22)4-5-14(15)21(29)27(2)10-16-19(17(8-23)28(3)26-16)12-6-18(30-11)20(24)25-9-12/h4-7,9,11H,10H2,1-3H3,(H2,24,25)/t11-/m1/s1/i3D3 |
| InChIKey | IIXWYSCJSQVBQM-LMUHODJSSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| deulorlatinib (CHEBI:759965) has role antineoplastic agent (CHEBI:35610) |
| deulorlatinib (CHEBI:759965) is a pyrazolopyridine (CHEBI:46699) |
| INN | Source |
|---|---|
| deulorlatinib | WHO MedNet |