EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H17Cl2N5O2 |
| Net Charge | 0 |
| Average Mass | 478.339 |
| Monoisotopic Mass | 477.07593 |
| SMILES | C[C@H](Nc1ncnc2nccc(=O)c12)c1c(Cl)c2cccc(Cl)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C24H17Cl2N5O2/c1-13(30-23-19-17(32)10-11-27-22(19)28-12-29-23)21-20(26)15-8-5-9-16(25)18(15)24(33)31(21)14-6-3-2-4-7-14/h2-13H,1H3,(H2,27,28,29,30,32)/t13-/m0/s1 |
| InChIKey | HIXUFHUKIOTXLJ-ZDUSSCGKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bosmolisib (CHEBI:759962) has role antineoplastic agent (CHEBI:35610) |
| bosmolisib (CHEBI:759962) is a isoquinolines (CHEBI:24922) |
| INN | Source |
|---|---|
| bosmolisib | WHO MedNet |
| Synonyms | Source |
|---|---|
| BR-101801 | ChEMBL |
| BR101801 | ChEMBL |