EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C38H48ClN5O6S |
| Net Charge | 0 |
| Average Mass | 738.351 |
| Monoisotopic Mass | 737.30138 |
| SMILES | [H][C@@]12CC[C@@]1([H])[C@@H](OC)/C=C/C[C@H](C)C[SH](=O)(NC(=O)c1cn(C)nc1OC)NC(=O)c1ccc3c(c1)N(C[C@@]1(CCCc4cc(Cl)ccc41)CO3)C2 |
| InChI | InChI=1S/C38H48ClN5O6S/c1-24-7-5-9-33(48-3)29-13-10-27(29)19-44-22-38(16-6-8-25-17-28(39)12-14-31(25)38)23-50-34-15-11-26(18-32(34)44)35(45)41-51(47,21-24)42-36(46)30-20-43(2)40-37(30)49-4/h5,9,11-12,14-15,17-18,20,24,27,29,33,51H,6-8,10,13,16,19,21-23H2,1-4H3,(H2,41,42,45,46,47)/b9-5+/t24-,27-,29+,33-,38-/m0/s1 |
| InChIKey | DROQXFHGKCGWRN-NPMSUDDJSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zamzetoclax (CHEBI:759955) has role antineoplastic agent (CHEBI:35610) |
| zamzetoclax (CHEBI:759955) is a tetralins (CHEBI:36786) |
| INN | Source |
|---|---|
| zamzetoclax | WHO MedNet |