EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H36F2N4O5 |
| Net Charge | 0 |
| Average Mass | 642.703 |
| Monoisotopic Mass | 642.26538 |
| SMILES | COc1cc2c(Oc3ccc(NC(=O)C4(C(=O)Nc5ccc(F)cc5)CC4)cc3F)ccnc2cc1OCC1(NC2CCCC2)CC1 |
| InChI | InChI=1S/C36H36F2N4O5/c1-45-31-19-26-28(20-32(31)46-21-35(13-14-35)42-24-4-2-3-5-24)39-17-12-29(26)47-30-11-10-25(18-27(30)38)41-34(44)36(15-16-36)33(43)40-23-8-6-22(37)7-9-23/h6-12,17-20,24,42H,2-5,13-16,21H2,1H3,(H,40,43)(H,41,44) |
| InChIKey | IXDALXNUFGTEMF-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vilzemetkib (CHEBI:759954) has role antineoplastic agent (CHEBI:35610) |
| vilzemetkib (CHEBI:759954) is a aromatic ether (CHEBI:35618) |
| INN | Source |
|---|---|
| vilzemetkib | WHO MedNet |