EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H34ClFN6O3 |
| Net Charge | 0 |
| Average Mass | 605.114 |
| Monoisotopic Mass | 604.23649 |
| SMILES | C=C(F)C(=O)N1CCN(c2nc(OC[C@@H]3CCCN3C)nc3c2CO[C@H](c2cccc4cccc(Cl)c24)C3)C[C@@H]1CC#N |
| InChI | InChI=1S/C32H34ClFN6O3/c1-20(34)31(41)40-15-14-39(17-22(40)11-12-35)30-25-19-42-28(24-9-3-6-21-7-4-10-26(33)29(21)24)16-27(25)36-32(37-30)43-18-23-8-5-13-38(23)2/h3-4,6-7,9-10,22-23,28H,1,5,8,11,13-19H2,2H3/t22-,23-,28-/m0/s1 |
| InChIKey | DOUDKPJUSUTSCJ-LXWOLXCRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| talorasib (CHEBI:759952) has role antineoplastic agent (CHEBI:35610) |
| talorasib (CHEBI:759952) is a N-arylpiperazine (CHEBI:46848) |
| INN | Source |
|---|---|
| talorasib | WHO MedNet |