EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C30H43NO6 |
| Net Charge | 0 |
| Average Mass | 513.675 |
| Monoisotopic Mass | 513.30904 |
| SMILES | [H][C@@]12C=C(C)CC[C@@]1([H])C(C)(C)Oc1cc(CCCCC)cc(OC(=O)[C@@H](NC(=O)CCC(=O)O)C(C)C)c12 |
| InChI | InChI=1S/C30H43NO6/c1-7-8-9-10-20-16-23(36-29(35)28(18(2)3)31-25(32)13-14-26(33)34)27-21-15-19(4)11-12-22(21)30(5,6)37-24(27)17-20/h15-18,21-22,28H,7-14H2,1-6H3,(H,31,32)(H,33,34)/t21-,22-,28+/m1/s1 |
| InChIKey | QAIKRQKSCBZKKS-XJGOYTCSSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| suvadronabinol (CHEBI:759951) is a N-acyl-amino acid (CHEBI:51569) |
| INN | Source |
|---|---|
| suvadronabinol | WHO MedNet |