EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:759945 - potrasertib
| Formula | C28H30Cl2N8O |
| Net Charge | 0 |
| Average Mass | 565.509 |
| Monoisotopic Mass | 564.19196 |
| SMILES | Cc1cc(Nc2ncc3c(n2)N2CCN=C2N(c2c(Cl)cccc2Cl)C3=O)ccc1N1C[C@@H](C)N(C)[C@@H](C)C1 |
| InChI | InChI=1S/C28H30Cl2N8O/c1-16-12-19(8-9-23(16)36-14-17(2)35(4)18(3)15-36)33-27-32-13-20-25(34-27)37-11-10-31-28(37)38(26(20)39)24-21(29)6-5-7-22(24)30/h5-9,12-13,17-18H,10-11,14-15H2,1-4H3,(H,32,33,34)/t17-,18+ |
| InChIKey | BNVDJVMTLDUCGH-HDICACEKSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| potrasertib (CHEBI:759945) has role antineoplastic agent (CHEBI:35610) |
| potrasertib (CHEBI:759945) is a piperazines (CHEBI:26144) |
| INN | Source |
|---|---|
| potrasertib | WHO MedNet |