EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H18F3N3O4 |
| Net Charge | 0 |
| Average Mass | 421.375 |
| Monoisotopic Mass | 421.12494 |
| SMILES | [H][C@]12CCCCN(C1)C(=O)c1c(O)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn12 |
| InChI | InChI=1S/C20H18F3N3O4/c21-10-5-14(22)12(15(23)6-10)7-24-19(29)13-9-26-11-3-1-2-4-25(8-11)20(30)16(26)18(28)17(13)27/h5-6,9,11,28H,1-4,7-8H2,(H,24,29)/t11-/m0/s1 |
| InChIKey | XMSYHEQGNQFEEZ-NSHDSACASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | antiviral agent A substance that destroys or inhibits replication of viruses. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| odentegravir (CHEBI:759943) has role antiviral agent (CHEBI:22587) |
| odentegravir (CHEBI:759943) is a aromatic carboxylic acid (CHEBI:33859) |
| odentegravir (CHEBI:759943) is a pyridinemonocarboxylic acid (CHEBI:26420) |
| INN | Source |
|---|---|
| odentegravir | WHO MedNet |