EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H10NO2 |
| Net Charge | 0 |
| Average Mass | 295.090 |
| Monoisotopic Mass | 294.97728 |
| SMILES | N[C@@H](Cc1ccc([131I])cc1)C(=O)O |
| InChI | InChI=1S/C9H10INO2/c10-7-3-1-6(2-4-7)5-8(11)9(12)13/h1-4,8H,5,11H2,(H,12,13)/t8-/m0/s1/i10+4 |
| InChIKey | PZNQZSRPDOEBMS-WPUCPVGPSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| iodofalan i-131 (CHEBI:759937) has role antineoplastic agent (CHEBI:35610) |
| iodofalan i-131 (CHEBI:759937) is a phenylalanine derivative (CHEBI:25985) |
| INNs | Source |
|---|---|
| iodofalan (131i) | WHO MedNet |
| iodofalan i-131 | WHO MedNet |
| Synonyms | Source |
|---|---|
| 131I-TLX-101 | ChEMBL |
| 4-(131i)iodo-l-phenylalanine | ChEMBL |
| 4-(iodo-131i)-l-phenylalanine | ChEMBL |
| 4-iodo-l-phenylalanine-131i | ChEMBL |
| 4-iodophenylalanine i-131 | ChEMBL |
| ACD-101 | ChEMBL |