EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C29H40N8OS |
| Net Charge | 0 |
| Average Mass | 548.761 |
| Monoisotopic Mass | 548.30458 |
| SMILES | CN1CCN(C2CCN(c3ccc(Nc4ncc5sc(C(=O)N(C)C)c(C6CCCC6)c5n4)nc3)CC2)CC1 |
| InChI | InChI=1S/C29H40N8OS/c1-34(2)28(38)27-25(20-6-4-5-7-20)26-23(39-27)19-31-29(33-26)32-24-9-8-22(18-30-24)36-12-10-21(11-13-36)37-16-14-35(3)15-17-37/h8-9,18-21H,4-7,10-17H2,1-3H3,(H,30,31,32,33) |
| InChIKey | PGGPKYATZSPYKB-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| fovinaciclib (CHEBI:759930) has role antineoplastic agent (CHEBI:35610) |
| fovinaciclib (CHEBI:759930) is a organic heterobicyclic compound (CHEBI:27171) |
| fovinaciclib (CHEBI:759930) is a organonitrogen heterocyclic compound (CHEBI:38101) |
| fovinaciclib (CHEBI:759930) is a organosulfur heterocyclic compound (CHEBI:38106) |
| INN | Source |
|---|---|
| fovinaciclib | WHO MedNet |