EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H30D3N7O2 |
| Net Charge | 0 |
| Average Mass | 502.637 |
| Monoisotopic Mass | 502.28840 |
| SMILES | [2H]C([2H])([2H])n1cc(-c2ccnc(Nc3cc(NC(=O)C=C)c(N(C)CCN(C)C)cc3OC)n2)c2ccccc21 |
| InChI | InChI=1S/C28H33N7O2/c1-7-27(36)30-22-16-23(26(37-6)17-25(22)34(4)15-14-33(2)3)32-28-29-13-12-21(31-28)20-18-35(5)24-11-9-8-10-19(20)24/h7-13,16-18H,1,14-15H2,2-6H3,(H,30,36)(H,29,31,32)/i5D3 |
| InChIKey | DUYJMQONPNNFPI-VPYROQPTSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asandeutertinib (CHEBI:759926) has role antineoplastic agent (CHEBI:35610) |
| asandeutertinib (CHEBI:759926) is a indoles (CHEBI:24828) |
| INN | Source |
|---|---|
| asandeutertinib | WHO MedNet |
| Synonym | Source |
|---|---|
| Osimertinib-d3 | ChEMBL |