EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H24F3N3O4 |
| Net Charge | 0 |
| Average Mass | 439.434 |
| Monoisotopic Mass | 439.17189 |
| SMILES | COc1c(N2C[C@H](CNC3CC3)[C@H](F)C2)c(F)cc2c(=O)c(C(=O)O)cn(CCF)c12 |
| InChI | InChI=1S/C21H24F3N3O4/c1-31-20-17-13(19(28)14(21(29)30)9-26(17)5-4-22)6-15(23)18(20)27-8-11(16(24)10-27)7-25-12-2-3-12/h6,9,11-12,16,25H,2-5,7-8,10H2,1H3,(H,29,30)/t11-,16+/m0/s1 |
| InChIKey | ZFIOCUITTUUVPV-MEDUHNTESA-N |
| Roles Classification |
|---|
| Biological Role: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| lascufloxacin (CHEBI:759924) has role antibacterial agent (CHEBI:33282) |
| lascufloxacin (CHEBI:759924) is a quinolines (CHEBI:26513) |
| INNs | Source |
|---|---|
| lascufloxacine | WHO MedNet |
| lascufloxacino | WHO MedNet |
| Synonym | Source |
|---|---|
| Lascufloxacin | ChEMBL |