EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H27F3N2O3 |
| Net Charge | 0 |
| Average Mass | 472.507 |
| Monoisotopic Mass | 472.19738 |
| SMILES | O=C(O)c1ccc(C2(NC(=O)[C@H]3CC4(CCN3Cc3ccc(C(F)(F)F)cc3)CC4)CC2)cc1 |
| InChI | InChI=1S/C26H27F3N2O3/c27-26(28,29)20-5-1-17(2-6-20)16-31-14-13-24(9-10-24)15-21(31)22(32)30-25(11-12-25)19-7-3-18(4-8-19)23(33)34/h1-8,21H,9-16H2,(H,30,32)(H,33,34)/t21-/m1/s1 |
| InChIKey | CADWTPLFEZSAHM-OAQYLSRUSA-N |
| Roles Classification |
|---|
| Applications: | antirheumatic drug A drug used to treat rheumatoid arthritis. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| vorbipiprant (CHEBI:759912) has role antineoplastic agent (CHEBI:35610) |
| vorbipiprant (CHEBI:759912) has role antirheumatic drug (CHEBI:35842) |
| vorbipiprant (CHEBI:759912) is a piperidines (CHEBI:26151) |
| INN | Source |
|---|---|
| vorbipiprant | WHO MedNet |
| Synonyms | Source |
|---|---|
| Cr 6086 | ChEMBL |
| CR-6086 | ChEMBL |
| CR6086 | ChEMBL |