EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H22F2N8O10P2S2 |
| Net Charge | 0 |
| Average Mass | 710.531 |
| Monoisotopic Mass | 710.03436 |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@@H]2CO[P@@](=O)(S)O[C@@H]3[C@H](O)[C@@H](CO[P@@](=O)(S)O[C@H]2[C@H]1F)O[C@H]3n1cc(F)c2c(=O)ncnc21 |
| InChI | InChI=1S/C21H22F2N8O10P2S2/c22-7-1-30(17-10(7)19(33)28-5-26-17)21-15-13(32)8(38-21)2-36-42(34,44)40-14-9(3-37-43(35,45)41-15)39-20(11(14)23)31-6-29-12-16(24)25-4-27-18(12)31/h1,4-6,8-9,11,13-15,20-21,32H,2-3H2,(H,34,44)(H,35,45)(H2,24,25,27)(H,26,28,33)/t8-,9-,11-,13-,14-,15-,20-,21-,42-,43-/m1/s1 |
| InChIKey | SIIGKCBSQKWSLM-RNPBXGGWSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| dazostinag (CHEBI:759892) has role antineoplastic agent (CHEBI:35610) |
| dazostinag (CHEBI:759892) is a nucleobase-containing molecular entity (CHEBI:61120) |
| INN | Source |
|---|---|
| dazostinag | WHO MedNet |
| Synonym | Source |
|---|---|
| TAK-676 | ChEMBL |