EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H18FN5O2 |
| Net Charge | 0 |
| Average Mass | 403.417 |
| Monoisotopic Mass | 403.14445 |
| SMILES | [H][C@]12COc3ccc(F)c(c31)CNc1c(cc(-c3cccnc3C)c3nncn13)OC2 |
| InChI | InChI=1S/C22H18FN5O2/c1-12-14(3-2-6-24-12)15-7-19-22(28-11-26-27-21(15)28)25-8-16-17(23)4-5-18-20(16)13(9-29-18)10-30-19/h2-7,11,13,25H,8-10H2,1H3/t13-/m1/s1 |
| InChIKey | JQBUTSBIFNKJMW-CYBMUJFWSA-N |
| Roles Classification |
|---|
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pociredir (CHEBI:759888) has role anti-anaemic agent (CHEBI:75835) |
| pociredir (CHEBI:759888) is a bipyridines (CHEBI:50511) |
| INN | Source |
|---|---|
| pociredir | WHO MedNet |
| Synonym | Source |
|---|---|
| FTX-6058 | ChEMBL |
| Citations |
|---|