EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
We are looking for a new Chemistry curator to join the ChEBI team. Find out more about it here.
CHEBI:759877 - zoracopan
| Formula | C31H31BrN6O3 |
| Net Charge | 0 |
| Average Mass | 615.532 |
| Monoisotopic Mass | 614.16410 |
| SMILES | CC(=O)c1cn(CC(=O)N2[C@H](C(=O)Nc3nc(Br)ccc3C)C[C@@]3(C)C[C@@H]23)c2c(C)cc(-c3cnc(C)nc3)cc12 |
| InChI | InChI=1S/C31H31BrN6O3/c1-16-6-7-26(32)35-29(16)36-30(41)24-10-31(5)11-25(31)38(24)27(40)15-37-14-23(18(3)39)22-9-20(8-17(2)28(22)37)21-12-33-19(4)34-13-21/h6-9,12-14,24-25H,10-11,15H2,1-5H3,(H,35,36,41)/t24-,25+,31-/m0/s1 |
| InChIKey | UXNFPLOWFUTNEC-NTWBYJAHSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zoracopan (CHEBI:759877) is a amino acid amide (CHEBI:22475) |
| INN | Source |
|---|---|
| zoracopan | WHO MedNet |
| Synonyms | Source |
|---|---|
| Alxn2080 | ChEMBL |
| ALXN-2080 | ChEMBL |