EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H36N6O3 |
| Net Charge | 0 |
| Average Mass | 504.635 |
| Monoisotopic Mass | 504.28489 |
| SMILES | C=CC(=O)N1CCN([C@@H](CC2CC2)c2ccc([C@H](C)Nc3ncc4c(n3)N(CC)C(=O)OC4)cc2)CC1 |
| InChI | InChI=1S/C28H36N6O3/c1-4-25(35)33-14-12-32(13-15-33)24(16-20-6-7-20)22-10-8-21(9-11-22)19(3)30-27-29-17-23-18-37-28(36)34(5-2)26(23)31-27/h4,8-11,17,19-20,24H,1,5-7,12-16,18H2,2-3H3,(H,29,30,31)/t19-,24-/m0/s1 |
| InChIKey | AFGYODUJVVOZAX-CYFREDJKSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| crelosidenib (CHEBI:759876) has role antineoplastic agent (CHEBI:35610) |
| crelosidenib (CHEBI:759876) is a secondary amine (CHEBI:32863) |
| INN | Source |
|---|---|
| crelosidenib | WHO MedNet |
| Synonyms | Source |
|---|---|
| LSN-3856920 | ChEMBL |
| LSN3856920 | ChEMBL |
| Ly 3410738 | ChEMBL |
| LY-3410738 | ChEMBL |
| LY3410738 | ChEMBL |