EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C26H30FN7O |
| Net Charge | 0 |
| Average Mass | 475.572 |
| Monoisotopic Mass | 475.24959 |
| SMILES | COc1cc2c(-c3cnn4cc(N5CCC(N6CCN(C)CC6)CC5)cnc34)ccnc2cc1F |
| InChI | InChI=1S/C26H30FN7O/c1-31-9-11-33(12-10-31)18-4-7-32(8-5-18)19-15-29-26-22(16-30-34(26)17-19)20-3-6-28-24-14-23(27)25(35-2)13-21(20)24/h3,6,13-18H,4-5,7-12H2,1-2H3 |
| InChIKey | UYQADNMBNQEQQG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | anti-anaemic agent A compound which increases either the number of red cells or the amount of haemoglobin in the blood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ker-047 (CHEBI:759874) has role anti-anaemic agent (CHEBI:75835) |
| ker-047 (CHEBI:759874) is a organohalogen compound (CHEBI:17792) |
| ker-047 (CHEBI:759874) is a quinolines (CHEBI:26513) |
| Synonyms | Source |
|---|---|
| Ker-047 | ChEMBL |
| KER047 | ChEMBL |