EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C32H44N4O4 |
| Net Charge | 0 |
| Average Mass | 548.728 |
| Monoisotopic Mass | 548.33626 |
| SMILES | CCc1c(N(CC)C2CCOCC2)cc2oc(CN3CCCCC3)cc2c1C(=O)NCc1c(C)cc(C)nc1=O |
| InChI | InChI=1S/C32H44N4O4/c1-5-25-28(36(6-2)23-10-14-39-15-11-23)18-29-26(17-24(40-29)20-35-12-8-7-9-13-35)30(25)32(38)33-19-27-21(3)16-22(4)34-31(27)37/h16-18,23H,5-15,19-20H2,1-4H3,(H,33,38)(H,34,37) |
| InChIKey | YLZVNQZYAYVUCW-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| zeprumetostat (CHEBI:759871) has role antineoplastic agent (CHEBI:35610) |
| zeprumetostat (CHEBI:759871) is a benzamides (CHEBI:22702) |
| INN | Source |
|---|---|
| zeprumetostat | WHO MedNet |